C12H17F3N2O2S — CID 114526886
2-[3-(dimethylamino)propylsulfonyl]-5-(trifluoromethyl)aniline (PubChem CID 114526886) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylsulfonyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[3-(dimethylamino)propylsulfonyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114526886 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-[3-(dimethylamino)propylsulfonyl]-5-(trifluoromethyl)aniline |
| SMILES | CN(C)CCCS(=O)(=O)c1ccc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H17F3N2O2S/c1-17(2)6-3-7-20(18,19)11-5-4-9(8-10(11)16)12(13,14)15/h4-5,8H,3,6-7,16H2,1-2H3 |
| InChIKey | WEQCJZKAWGOFAB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|