C9H9F4NO4S2 — CID 107303968
2-[2-fluoro-4-(trifluoromethyl)phenyl]sulfonylethanesulfonamide (PubChem CID 107303968) has the molecular formula C9H9F4NO4S2 and a molecular weight of 335.30 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethyl)phenyl]sulfonylethanesulfonamide.
| Compound Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]sulfonylethanesulfonamide |
|---|---|
| PubChem CID | 107303968 |
| Molecular Formula | C9H9F4NO4S2 |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethyl)phenyl]sulfonylethanesulfonamide |
| SMILES | NS(=O)(=O)CCS(=O)(=O)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H9F4NO4S2/c10-7-5-6(9(11,12)13)1-2-8(7)19(15,16)3-4-20(14,17)18/h1-2,5H,3-4H2,(H2,14,17,18) |
| InChIKey | MGYANJDXZKAJQP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |