C18H16F8O4S2 — CID 157365281
2-ethylsulfonyl-1-fluoro-4-(trifluoromethyl)benzene (PubChem CID 157365281) has the molecular formula C18H16F8O4S2 and a molecular weight of 512.44 g/mol. Its IUPAC name is 2-ethylsulfonyl-1-fluoro-4-(trifluoromethyl)benzene.
| Compound Name | 2-ethylsulfonyl-1-fluoro-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 157365281 |
| Molecular Formula | C18H16F8O4S2 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-ethylsulfonyl-1-fluoro-4-(trifluoromethyl)benzene |
| SMILES | CCS(=O)(=O)c1cc(C(F)(F)F)ccc1F.CCS(=O)(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/2C9H8F4O2S/c2*1-2-16(14,15)8-5-6(9(11,12)13)3-4-7(8)10/h2*3-5H,2H2,1H3 |
| InChIKey | BJCJRUWEPKHKGU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |