C13H16F4N2O2S — CID 119966041
2-fluoro-N-methyl-N-piperidin-4-yl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 119966041) has the molecular formula C13H16F4N2O2S and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-piperidin-4-yl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-methyl-N-piperidin-4-yl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119966041 |
| Molecular Formula | C13H16F4N2O2S |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-fluoro-N-methyl-N-piperidin-4-yl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(C1CCNCC1)S(=O)(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H16F4N2O2S/c1-19(10-4-6-18-7-5-10)22(20,21)12-8-9(13(15,16)17)2-3-11(12)14/h2-3,8,10,18H,4-7H2,1H3 |
| InChIKey | ZOPXPRBOWINDEB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |