C14H19F2NO2S — CID 60545461
2,5-difluoro-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide (PubChem CID 60545461) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is 2,5-difluoro-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60545461 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2,5-difluoro-N-methyl-N-(4-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCC(N(C)S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C14H19F2NO2S/c1-10-3-6-12(7-4-10)17(2)20(18,19)14-9-11(15)5-8-13(14)16/h5,8-10,12H,3-4,6-7H2,1-2H3 |
| InChIKey | RPEKDZOUXAYSPV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |