C15H22FNO3S — CID 102919775
5-fluoro-2-(hydroxymethyl)-N-methyl-N-(3-methylcyclohexyl)benzenesulfonamide (PubChem CID 102919775) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is 5-fluoro-2-(hydroxymethyl)-N-methyl-N-(3-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 5-fluoro-2-(hydroxymethyl)-N-methyl-N-(3-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 102919775 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-fluoro-2-(hydroxymethyl)-N-methyl-N-(3-methylcyclohexyl)benzenesulfonamide |
| SMILES | CC1CCCC(N(C)S(=O)(=O)c2cc(F)ccc2CO)C1 |
| InChI | InChI=1S/C15H22FNO3S/c1-11-4-3-5-14(8-11)17(2)21(19,20)15-9-13(16)7-6-12(15)10-18/h6-7,9,11,14,18H,3-5,8,10H2,1-2H3 |
| InChIKey | HYJJNPLIYXZXSH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |