C14H19F4NO3S — CID 75471853
2-fluoro-N-(2-hydroxyethyl)-N-pentan-3-yl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 75471853) has the molecular formula C14H19F4NO3S and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxyethyl)-N-pentan-3-yl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-hydroxyethyl)-N-pentan-3-yl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 75471853 |
| Molecular Formula | C14H19F4NO3S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-fluoro-N-(2-hydroxyethyl)-N-pentan-3-yl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCC(CC)N(CCO)S(=O)(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C14H19F4NO3S/c1-3-11(4-2)19(7-8-20)23(21,22)13-9-10(14(16,17)18)5-6-12(13)15/h5-6,9,11,20H,3-4,7-8H2,1-2H3 |
| InChIKey | CVMCPFNAJILTLN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |