C13H18BrF2NO2S — CID 80675253
N-(2-bromoethyl)-2,5-difluoro-N-pentan-3-ylbenzenesulfonamide (PubChem CID 80675253) has the molecular formula C13H18BrF2NO2S and a molecular weight of 370.26 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,5-difluoro-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | N-(2-bromoethyl)-2,5-difluoro-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 80675253 |
| Molecular Formula | C13H18BrF2NO2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | N-(2-bromoethyl)-2,5-difluoro-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCC(CC)N(CCBr)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H18BrF2NO2S/c1-3-11(4-2)17(8-7-14)20(18,19)13-9-10(15)5-6-12(13)16/h5-6,9,11H,3-4,7-8H2,1-2H3 |
| InChIKey | UCXGKCJOLBIMSG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|