C16H17F2NO2S — CID 60516930
N-benzyl-2,5-difluoro-N-propan-2-ylbenzenesulfonamide (PubChem CID 60516930) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is N-benzyl-2,5-difluoro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | N-benzyl-2,5-difluoro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 60516930 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-benzyl-2,5-difluoro-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(Cc1ccccc1)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H17F2NO2S/c1-12(2)19(11-13-6-4-3-5-7-13)22(20,21)16-10-14(17)8-9-15(16)18/h3-10,12H,11H2,1-2H3 |
| InChIKey | QDUSKRPLRIWICL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |