C15H15F2NO3S — CID 94824462
2,5-difluoro-N-[(2S)-2-hydroxypropyl]-N-phenylbenzenesulfonamide (PubChem CID 94824462) has the molecular formula C15H15F2NO3S and a molecular weight of 327.35 g/mol. Its IUPAC name is 2,5-difluoro-N-[(2S)-2-hydroxypropyl]-N-phenylbenzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[(2S)-2-hydroxypropyl]-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 94824462 |
| Molecular Formula | C15H15F2NO3S |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2,5-difluoro-N-[(2S)-2-hydroxypropyl]-N-phenylbenzenesulfonamide |
| SMILES | C[C@H](O)CN(c1ccccc1)S(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H15F2NO3S/c1-11(19)10-18(13-5-3-2-4-6-13)22(20,21)15-9-12(16)7-8-14(15)17/h2-9,11,19H,10H2,1H3/t11-/m0/s1 |
| InChIKey | RJQIUFMJBFCRDB-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |