C7H5ClF4O3S — CID 174972192
2-fluoro-5-(trifluoromethyl)benzenesulfonic acid;hydrochloride (PubChem CID 174972192) has the molecular formula C7H5ClF4O3S and a molecular weight of 280.63 g/mol. Its IUPAC name is 2-fluoro-5-(trifluoromethyl)benzenesulfonic acid;hydrochloride.
| Compound Name | 2-fluoro-5-(trifluoromethyl)benzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174972192 |
| Molecular Formula | C7H5ClF4O3S |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 2-fluoro-5-(trifluoromethyl)benzenesulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C7H4F4O3S.ClH/c8-5-2-1-4(7(9,10)11)3-6(5)15(12,13)14;/h1-3H,(H,12,13,14);1H |
| InChIKey | KUWJHKBBIFJMQG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|