C6H5ClF2O3S — CID 174777821
2,5-difluorobenzenesulfonic acid;hydrochloride (PubChem CID 174777821) has the molecular formula C6H5ClF2O3S and a molecular weight of 230.62 g/mol. Its IUPAC name is 2,5-difluorobenzenesulfonic acid;hydrochloride.
| Compound Name | 2,5-difluorobenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174777821 |
| Molecular Formula | C6H5ClF2O3S |
| Molecular Weight | 230.62 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 2,5-difluorobenzenesulfonic acid;hydrochloride |
| SMILES | Cl.O=S(=O)(O)c1cc(F)ccc1F |
| InChI | InChI=1S/C6H4F2O3S.ClH/c7-4-1-2-5(8)6(3-4)12(9,10)11;/h1-3H,(H,9,10,11);1H |
| InChIKey | GLLIQSAYBZMYIM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.62 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|