C12H8F2Na2O8S3 — CID 131852252
CID 131852252 (PubChem CID 131852252) has the molecular formula C12H8F2Na2O8S3 and a molecular weight of 460.37 g/mol.
| Compound Name | CID 131852252 |
|---|---|
| PubChem CID | 131852252 |
| Molecular Formula | C12H8F2Na2O8S3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.91 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cc(S(=O)(=O)c2ccc(F)c(S(=O)(=O)O)c2)ccc1F.[Na].[Na] |
| InChI | InChI=1S/C12H8F2O8S3.2Na/c13-9-3-1-7(5-11(9)24(17,18)19)23(15,16)8-2-4-10(14)12(6-8)25(20,21)22;;/h1-6H,(H,17,18,19)(H,20,21,22);; |
| InChIKey | USGAMUPWNZWVJG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|