C18H13F2O10PS3 — CID 75493005
2-fluoro-5-[(4-fluoro-3-sulfophenyl)-(3-sulfophenyl)phosphoryl]benzenesulfonic acid (PubChem CID 75493005) has the molecular formula C18H13F2O10PS3 and a molecular weight of 554.46 g/mol. Its IUPAC name is 2-fluoro-5-[(4-fluoro-3-sulfophenyl)-(3-sulfophenyl)phosphoryl]benzenesulfonic acid.
| Compound Name | 2-fluoro-5-[(4-fluoro-3-sulfophenyl)-(3-sulfophenyl)phosphoryl]benzenesulfonic acid |
|---|---|
| PubChem CID | 75493005 |
| Molecular Formula | C18H13F2O10PS3 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 553.94 |
| IUPAC Name | 2-fluoro-5-[(4-fluoro-3-sulfophenyl)-(3-sulfophenyl)phosphoryl]benzenesulfonic acid |
| SMILES | O=P(c1cccc(S(=O)(=O)O)c1)(c1ccc(F)c(S(=O)(=O)O)c1)c1ccc(F)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H13F2O10PS3/c19-15-6-4-12(9-17(15)33(25,26)27)31(21,11-2-1-3-14(8-11)32(22,23)24)13-5-7-16(20)18(10-13)34(28,29)30/h1-10H,(H,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | QNRCNSFPUDJZMJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 180.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|