C18H13F2O4PS — CID 75493014
3-bis(4-fluorophenyl)phosphorylbenzenesulfonic acid (PubChem CID 75493014) has the molecular formula C18H13F2O4PS and a molecular weight of 394.34 g/mol. Its IUPAC name is 3-bis(4-fluorophenyl)phosphorylbenzenesulfonic acid.
| Compound Name | 3-bis(4-fluorophenyl)phosphorylbenzenesulfonic acid |
|---|---|
| PubChem CID | 75493014 |
| Molecular Formula | C18H13F2O4PS |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 3-bis(4-fluorophenyl)phosphorylbenzenesulfonic acid |
| SMILES | O=P(c1ccc(F)cc1)(c1ccc(F)cc1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H13F2O4PS/c19-13-4-8-15(9-5-13)25(21,16-10-6-14(20)7-11-16)17-2-1-3-18(12-17)26(22,23)24/h1-12H,(H,22,23,24) |
| InChIKey | IRAUTESVZZIKKM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|