About bis(3-aminobenzenesulfonic acid);sulfane
bis(3-aminobenzenesulfonic acid);sulfane (PubChem CID 175800902) has the molecular formula C12H16N2O6S3
and a molecular weight of 380.47 g/mol. Its IUPAC name is bis(3-aminobenzenesulfonic acid);sulfane.
Molecular Properties
| Compound Name | bis(3-aminobenzenesulfonic acid);sulfane |
| PubChem CID | 175800902 |
| Molecular Formula | C12H16N2O6S3 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | bis(3-aminobenzenesulfonic acid);sulfane |
| SMILES | Nc1cccc(S(=O)(=O)O)c1.Nc1cccc(S(=O)(=O)O)c1.S |
| InChI | InChI=1S/2C6H7NO3S.H2S/c2*7-5-2-1-3-6(4-5)11(8,9)10;/h2*1-4H,7H2,(H,8,9,10);1H2 |
| InChIKey | JJJLDIBGFMGRPG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(3-aminobenzenesulfonic acid);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-aminobenzenesulfonic acid);sulfane?
The IUPAC name of bis(3-aminobenzenesulfonic acid);sulfane (CID 175800902) is bis(3-aminobenzenesulfonic acid);sulfane.
What is the SMILES notation for bis(3-aminobenzenesulfonic acid);sulfane?
The canonical SMILES for bis(3-aminobenzenesulfonic acid);sulfane is Nc1cccc(S(=O)(=O)O)c1.Nc1cccc(S(=O)(=O)O)c1.S.
What is the InChIKey of bis(3-aminobenzenesulfonic acid);sulfane?
The InChIKey is JJJLDIBGFMGRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H7NO3S.H2S/c2*7-5-2-1-3-6(4-5)11(8,9)10;/h2*1-4H,7H2,(H,8,9,10);1H2.
What are the key properties of bis(3-aminobenzenesulfonic acid);sulfane?
bis(3-aminobenzenesulfonic acid);sulfane has a molecular weight of 380.47 g/mol, XLogP of 1.14, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-aminobenzenesulfonic acid);sulfane is sourced from PubChem (CID 175800902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).