About 4-aminobenzenesulfonic acid;aniline
4-aminobenzenesulfonic acid;aniline (PubChem CID 163532590) has the molecular formula C18H21N3O3S
and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;aniline.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonic acid;aniline |
| PubChem CID | 163532590 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-aminobenzenesulfonic acid;aniline |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1.Nc1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C6H7NO3S.2C6H7N/c7-5-1-3-6(4-2-5)11(8,9)10;2*7-6-4-2-1-3-5-6/h1-4H,7H2,(H,8,9,10);2*1-5H,7H2 |
| InChIKey | DUGNOIBDBZEQJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonic acid;aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonic acid;aniline?
The IUPAC name of 4-aminobenzenesulfonic acid;aniline (CID 163532590) is 4-aminobenzenesulfonic acid;aniline.
What is the SMILES notation for 4-aminobenzenesulfonic acid;aniline?
The canonical SMILES for 4-aminobenzenesulfonic acid;aniline is Nc1ccc(S(=O)(=O)O)cc1.Nc1ccccc1.Nc1ccccc1.
What is the InChIKey of 4-aminobenzenesulfonic acid;aniline?
The InChIKey is DUGNOIBDBZEQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO3S.2C6H7N/c7-5-1-3-6(4-2-5)11(8,9)10;2*7-6-4-2-1-3-5-6/h1-4H,7H2,(H,8,9,10);2*1-5H,7H2.
What are the key properties of 4-aminobenzenesulfonic acid;aniline?
4-aminobenzenesulfonic acid;aniline has a molecular weight of 359.45 g/mol, XLogP of 3.05, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonic acid;aniline is sourced from PubChem (CID 163532590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).