About 4-aminobenzenesulfonic acid;2-methylphenol
4-aminobenzenesulfonic acid;2-methylphenol (PubChem CID 88815344) has the molecular formula C13H15NO4S
and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-aminobenzenesulfonic acid;2-methylphenol.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonic acid;2-methylphenol |
| PubChem CID | 88815344 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-aminobenzenesulfonic acid;2-methylphenol |
| SMILES | Cc1ccccc1O.Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O.C6H7NO3S/c1-6-4-2-3-5-7(6)8;7-5-1-3-6(4-2-5)11(8,9)10/h2-5,8H,1H3;1-4H,7H2,(H,8,9,10) |
| InChIKey | LJLLIZUSRHSCJL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonic acid;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonic acid;2-methylphenol?
The IUPAC name of 4-aminobenzenesulfonic acid;2-methylphenol (CID 88815344) is 4-aminobenzenesulfonic acid;2-methylphenol.
What is the SMILES notation for 4-aminobenzenesulfonic acid;2-methylphenol?
The canonical SMILES for 4-aminobenzenesulfonic acid;2-methylphenol is Cc1ccccc1O.Nc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of 4-aminobenzenesulfonic acid;2-methylphenol?
The InChIKey is LJLLIZUSRHSCJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H7NO3S/c1-6-4-2-3-5-7(6)8;7-5-1-3-6(4-2-5)11(8,9)10/h2-5,8H,1H3;1-4H,7H2,(H,8,9,10).
What are the key properties of 4-aminobenzenesulfonic acid;2-methylphenol?
4-aminobenzenesulfonic acid;2-methylphenol has a molecular weight of 281.33 g/mol, XLogP of 2.22, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonic acid;2-methylphenol is sourced from PubChem (CID 88815344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).