About methanamine;2-methylphenol
methanamine;2-methylphenol (PubChem CID 19359053) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is methanamine;2-methylphenol.
Molecular Properties
| Compound Name | methanamine;2-methylphenol |
| PubChem CID | 19359053 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | methanamine;2-methylphenol |
| SMILES | CN.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.CH5N/c1-6-4-2-3-5-7(6)8;1-2/h2-5,8H,1H3;2H2,1H3 |
| InChIKey | YRXZNNCHCIRMEY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methylphenol?
The IUPAC name of methanamine;2-methylphenol (CID 19359053) is methanamine;2-methylphenol.
What is the SMILES notation for methanamine;2-methylphenol?
The canonical SMILES for methanamine;2-methylphenol is CN.Cc1ccccc1O.
What is the InChIKey of methanamine;2-methylphenol?
The InChIKey is YRXZNNCHCIRMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CH5N/c1-6-4-2-3-5-7(6)8;1-2/h2-5,8H,1H3;2H2,1H3.
What are the key properties of methanamine;2-methylphenol?
methanamine;2-methylphenol has a molecular weight of 139.20 g/mol, XLogP of 1.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methylphenol is sourced from PubChem (CID 19359053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).