About hydrazine;2-methylphenol
hydrazine;2-methylphenol (PubChem CID 174667823) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is hydrazine;2-methylphenol.
Molecular Properties
| Compound Name | hydrazine;2-methylphenol |
| PubChem CID | 174667823 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | hydrazine;2-methylphenol |
| SMILES | Cc1ccccc1O.NN |
| InChI | InChI=1S/C7H8O.H4N2/c1-6-4-2-3-5-7(6)8;1-2/h2-5,8H,1H3;1-2H2 |
| InChIKey | RAJLZJLCPAMYGI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;2-methylphenol?
The IUPAC name of hydrazine;2-methylphenol (CID 174667823) is hydrazine;2-methylphenol.
What is the SMILES notation for hydrazine;2-methylphenol?
The canonical SMILES for hydrazine;2-methylphenol is Cc1ccccc1O.NN.
What is the InChIKey of hydrazine;2-methylphenol?
The InChIKey is RAJLZJLCPAMYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.H4N2/c1-6-4-2-3-5-7(6)8;1-2/h2-5,8H,1H3;1-2H2.
What are the key properties of hydrazine;2-methylphenol?
hydrazine;2-methylphenol has a molecular weight of 140.19 g/mol, XLogP of 0.52, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;2-methylphenol is sourced from PubChem (CID 174667823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).