About 2-methylphenol;nitromethane
2-methylphenol;nitromethane (PubChem CID 91443337) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-methylphenol;nitromethane.
Molecular Properties
| Compound Name | 2-methylphenol;nitromethane |
| PubChem CID | 91443337 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-methylphenol;nitromethane |
| SMILES | C[N+](=O)[O-].Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.CH3NO2/c1-6-4-2-3-5-7(6)8;1-2(3)4/h2-5,8H,1H3;1H3 |
| InChIKey | LPBOWXPZXCKBNX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylphenol;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;nitromethane?
The IUPAC name of 2-methylphenol;nitromethane (CID 91443337) is 2-methylphenol;nitromethane.
What is the SMILES notation for 2-methylphenol;nitromethane?
The canonical SMILES for 2-methylphenol;nitromethane is C[N+](=O)[O-].Cc1ccccc1O.
What is the InChIKey of 2-methylphenol;nitromethane?
The InChIKey is LPBOWXPZXCKBNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CH3NO2/c1-6-4-2-3-5-7(6)8;1-2(3)4/h2-5,8H,1H3;1H3.
What are the key properties of 2-methylphenol;nitromethane?
2-methylphenol;nitromethane has a molecular weight of 169.18 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;nitromethane is sourced from PubChem (CID 91443337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).