About hydroperoxymethane;2-methylphenol
hydroperoxymethane;2-methylphenol (PubChem CID 87131667) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is hydroperoxymethane;2-methylphenol.
Molecular Properties
| Compound Name | hydroperoxymethane;2-methylphenol |
| PubChem CID | 87131667 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | hydroperoxymethane;2-methylphenol |
| SMILES | COO.Cc1ccccc1O |
| InChI | InChI=1S/C7H8O.CH4O2/c1-6-4-2-3-5-7(6)8;1-3-2/h2-5,8H,1H3;2H,1H3 |
| InChIKey | SESUKTQUHMRTKJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydroperoxymethane;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroperoxymethane;2-methylphenol?
The IUPAC name of hydroperoxymethane;2-methylphenol (CID 87131667) is hydroperoxymethane;2-methylphenol.
What is the SMILES notation for hydroperoxymethane;2-methylphenol?
The canonical SMILES for hydroperoxymethane;2-methylphenol is COO.Cc1ccccc1O.
What is the InChIKey of hydroperoxymethane;2-methylphenol?
The InChIKey is SESUKTQUHMRTKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.CH4O2/c1-6-4-2-3-5-7(6)8;1-3-2/h2-5,8H,1H3;2H,1H3.
What are the key properties of hydroperoxymethane;2-methylphenol?
hydroperoxymethane;2-methylphenol has a molecular weight of 156.18 g/mol, XLogP of 1.81, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroperoxymethane;2-methylphenol is sourced from PubChem (CID 87131667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).