About 2-methylphenol;thiophene
2-methylphenol;thiophene (PubChem CID 158862587) has the molecular formula C11H12OS
and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-methylphenol;thiophene.
Molecular Properties
| Compound Name | 2-methylphenol;thiophene |
| PubChem CID | 158862587 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-methylphenol;thiophene |
| SMILES | Cc1ccccc1O.c1ccsc1 |
| InChI | InChI=1S/C7H8O.C4H4S/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1-4H |
| InChIKey | JAVGSMPWTMOXBR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylphenol;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylphenol;thiophene?
The IUPAC name of 2-methylphenol;thiophene (CID 158862587) is 2-methylphenol;thiophene.
What is the SMILES notation for 2-methylphenol;thiophene?
The canonical SMILES for 2-methylphenol;thiophene is Cc1ccccc1O.c1ccsc1.
What is the InChIKey of 2-methylphenol;thiophene?
The InChIKey is JAVGSMPWTMOXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C4H4S/c1-6-4-2-3-5-7(6)8;1-2-4-5-3-1/h2-5,8H,1H3;1-4H.
What are the key properties of 2-methylphenol;thiophene?
2-methylphenol;thiophene has a molecular weight of 192.28 g/mol, XLogP of 3.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylphenol;thiophene is sourced from PubChem (CID 158862587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).