About zinc 2-methylphenol
zinc 2-methylphenol (PubChem CID 10374903) has the molecular formula C7H8OZn+2
and a molecular weight of 173.53 g/mol. Its IUPAC name is zinc 2-methylphenol.
Molecular Properties
| Compound Name | zinc 2-methylphenol |
| PubChem CID | 10374903 |
| Molecular Formula | C7H8OZn+2 |
| Molecular Weight | 173.53 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | zinc 2-methylphenol |
| SMILES | Cc1ccccc1O.[Zn+2] |
| InChI | InChI=1S/C7H8O.Zn/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H3;/q;+2 |
| InChIKey | CIGVXDAHSHSSBG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 2-methylphenol?
The IUPAC name of zinc 2-methylphenol (CID 10374903) is zinc 2-methylphenol.
What is the SMILES notation for zinc 2-methylphenol?
The canonical SMILES for zinc 2-methylphenol is Cc1ccccc1O.[Zn+2].
What is the InChIKey of zinc 2-methylphenol?
The InChIKey is CIGVXDAHSHSSBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.Zn/c1-6-4-2-3-5-7(6)8;/h2-5,8H,1H3;/q;+2.
What are the key properties of zinc 2-methylphenol?
zinc 2-methylphenol has a molecular weight of 173.53 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 2-methylphenol is sourced from PubChem (CID 10374903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).