About 1,2-dichlorobenzene;2-methylphenol
1,2-dichlorobenzene;2-methylphenol (PubChem CID 159780398) has the molecular formula C13H12Cl2O
and a molecular weight of 255.14 g/mol. Its IUPAC name is 1,2-dichlorobenzene;2-methylphenol.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;2-methylphenol |
| PubChem CID | 159780398 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1,2-dichlorobenzene;2-methylphenol |
| SMILES | Cc1ccccc1O.Clc1ccccc1Cl |
| InChI | InChI=1S/C7H8O.C6H4Cl2/c1-6-4-2-3-5-7(6)8;7-5-3-1-2-4-6(5)8/h2-5,8H,1H3;1-4H |
| InChIKey | NHHAZCMGSKVCDI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dichlorobenzene;2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;2-methylphenol?
The IUPAC name of 1,2-dichlorobenzene;2-methylphenol (CID 159780398) is 1,2-dichlorobenzene;2-methylphenol.
What is the SMILES notation for 1,2-dichlorobenzene;2-methylphenol?
The canonical SMILES for 1,2-dichlorobenzene;2-methylphenol is Cc1ccccc1O.Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;2-methylphenol?
The InChIKey is NHHAZCMGSKVCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H4Cl2/c1-6-4-2-3-5-7(6)8;7-5-3-1-2-4-6(5)8/h2-5,8H,1H3;1-4H.
What are the key properties of 1,2-dichlorobenzene;2-methylphenol?
1,2-dichlorobenzene;2-methylphenol has a molecular weight of 255.14 g/mol, XLogP of 4.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;2-methylphenol is sourced from PubChem (CID 159780398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).