About CID 66838097
CID 66838097 (PubChem CID 66838097) has the molecular formula C7H7ClMg
and a molecular weight of 150.89 g/mol.
Molecular Properties
| Compound Name | CID 66838097 |
| PubChem CID | 66838097 |
| Molecular Formula | C7H7ClMg |
| Molecular Weight | 150.89 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1Cl.[Mg] |
| InChI | InChI=1S/C7H7Cl.Mg/c1-6-4-2-3-5-7(6)8;/h2-5H,1H3; |
| InChIKey | FVKPQIIZXIFJNH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.89 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 66838097 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66838097?
The IUPAC name of CID 66838097 (CID 66838097) is not available.
What is the SMILES notation for CID 66838097?
The canonical SMILES for CID 66838097 is Cc1ccccc1Cl.[Mg].
What is the InChIKey of CID 66838097?
The InChIKey is FVKPQIIZXIFJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.Mg/c1-6-4-2-3-5-7(6)8;/h2-5H,1H3;.
What are the key properties of CID 66838097?
CID 66838097 has a molecular weight of 150.89 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66838097 is sourced from PubChem (CID 66838097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).