About 1-chloro-2-methylbenzene;dihydrochloride
1-chloro-2-methylbenzene;dihydrochloride (PubChem CID 174485339) has the molecular formula C7H9Cl3
and a molecular weight of 199.51 g/mol. Its IUPAC name is 1-chloro-2-methylbenzene;dihydrochloride.
Molecular Properties
| Compound Name | 1-chloro-2-methylbenzene;dihydrochloride |
| PubChem CID | 174485339 |
| Molecular Formula | C7H9Cl3 |
| Molecular Weight | 199.51 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 1-chloro-2-methylbenzene;dihydrochloride |
| SMILES | Cc1ccccc1Cl.Cl.Cl |
| InChI | InChI=1S/C7H7Cl.2ClH/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H3;2*1H |
| InChIKey | SQJFIFZAMNQZPM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-methylbenzene;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methylbenzene;dihydrochloride?
The IUPAC name of 1-chloro-2-methylbenzene;dihydrochloride (CID 174485339) is 1-chloro-2-methylbenzene;dihydrochloride.
What is the SMILES notation for 1-chloro-2-methylbenzene;dihydrochloride?
The canonical SMILES for 1-chloro-2-methylbenzene;dihydrochloride is Cc1ccccc1Cl.Cl.Cl.
What is the InChIKey of 1-chloro-2-methylbenzene;dihydrochloride?
The InChIKey is SQJFIFZAMNQZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.2ClH/c1-6-4-2-3-5-7(6)8;;/h2-5H,1H3;2*1H.
What are the key properties of 1-chloro-2-methylbenzene;dihydrochloride?
1-chloro-2-methylbenzene;dihydrochloride has a molecular weight of 199.51 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methylbenzene;dihydrochloride is sourced from PubChem (CID 174485339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).