About 1,2-dichlorobenzene;hydrate;hydrochloride
1,2-dichlorobenzene;hydrate;hydrochloride (PubChem CID 141479272) has the molecular formula C6H7Cl3O
and a molecular weight of 201.48 g/mol. Its IUPAC name is 1,2-dichlorobenzene;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;hydrate;hydrochloride |
| PubChem CID | 141479272 |
| Molecular Formula | C6H7Cl3O |
| Molecular Weight | 201.48 g/mol |
| Exact Mass | 199.96 |
| IUPAC Name | 1,2-dichlorobenzene;hydrate;hydrochloride |
| SMILES | Cl.Clc1ccccc1Cl.O |
| InChI | InChI=1S/C6H4Cl2.ClH.H2O/c7-5-3-1-2-4-6(5)8;;/h1-4H;1H;1H2 |
| InChIKey | MJSQLANNSAZTES-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichlorobenzene;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;hydrate;hydrochloride?
The IUPAC name of 1,2-dichlorobenzene;hydrate;hydrochloride (CID 141479272) is 1,2-dichlorobenzene;hydrate;hydrochloride.
What is the SMILES notation for 1,2-dichlorobenzene;hydrate;hydrochloride?
The canonical SMILES for 1,2-dichlorobenzene;hydrate;hydrochloride is Cl.Clc1ccccc1Cl.O.
What is the InChIKey of 1,2-dichlorobenzene;hydrate;hydrochloride?
The InChIKey is MJSQLANNSAZTES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.ClH.H2O/c7-5-3-1-2-4-6(5)8;;/h1-4H;1H;1H2.
What are the key properties of 1,2-dichlorobenzene;hydrate;hydrochloride?
1,2-dichlorobenzene;hydrate;hydrochloride has a molecular weight of 201.48 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;hydrate;hydrochloride is sourced from PubChem (CID 141479272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).