C8H6CaCl2O4 — CID 174875023
calcium;1,2-dichlorobenzene;diformate (PubChem CID 174875023) has the molecular formula C8H6CaCl2O4 and a molecular weight of 277.12 g/mol. Its IUPAC name is calcium;1,2-dichlorobenzene;diformate.
| Compound Name | calcium;1,2-dichlorobenzene;diformate |
|---|---|
| PubChem CID | 174875023 |
| Molecular Formula | C8H6CaCl2O4 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.93 |
| IUPAC Name | calcium;1,2-dichlorobenzene;diformate |
| SMILES | Clc1ccccc1Cl.O=C[O-].O=C[O-].[Ca+2] |
| InChI | InChI=1S/C6H4Cl2.2CH2O2.Ca/c7-5-3-1-2-4-6(5)8;2*2-1-3;/h1-4H;2*1H,(H,2,3);/q;;;+2/p-2 |
| InChIKey | NWOZRKIWGFYORR-UHFFFAOYSA-L |
| XLogP | -0.66 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|