About diphenyllead(2+) diformate
diphenyllead(2+) diformate (PubChem CID 159711427) has the molecular formula C14H12O4Pb
and a molecular weight of 451.45 g/mol. Its IUPAC name is diphenyllead(2+) diformate.
Molecular Properties
| Compound Name | diphenyllead(2+) diformate |
| PubChem CID | 159711427 |
| Molecular Formula | C14H12O4Pb |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | diphenyllead(2+) diformate |
| SMILES | O=C[O-].O=C[O-].c1ccc([Pb+2]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H5.2CH2O2.Pb/c2*1-2-4-6-5-3-1;2*2-1-3;/h2*1-5H;2*1H,(H,2,3);/q;;;;+2/p-2 |
| InChIKey | MYWSTAZHXFDYSN-UHFFFAOYSA-L |
| XLogP | -1.93 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze diphenyllead(2+) diformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyllead(2+) diformate?
The IUPAC name of diphenyllead(2+) diformate (CID 159711427) is diphenyllead(2+) diformate.
What is the SMILES notation for diphenyllead(2+) diformate?
The canonical SMILES for diphenyllead(2+) diformate is O=C[O-].O=C[O-].c1ccc([Pb+2]c2ccccc2)cc1.
What is the InChIKey of diphenyllead(2+) diformate?
The InChIKey is MYWSTAZHXFDYSN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5.2CH2O2.Pb/c2*1-2-4-6-5-3-1;2*2-1-3;/h2*1-5H;2*1H,(H,2,3);/q;;;;+2/p-2.
What are the key properties of diphenyllead(2+) diformate?
diphenyllead(2+) diformate has a molecular weight of 451.45 g/mol, XLogP of -1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyllead(2+) diformate is sourced from PubChem (CID 159711427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).