About 1,1'-biphenyl;methanethioic S-acid
1,1'-biphenyl;methanethioic S-acid (PubChem CID 157330643) has the molecular formula C13H12OS
and a molecular weight of 216.31 g/mol. Its IUPAC name is 1,1'-biphenyl;methanethioic S-acid.
Molecular Properties
| Compound Name | 1,1'-biphenyl;methanethioic S-acid |
| PubChem CID | 157330643 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1,1'-biphenyl;methanethioic S-acid |
| SMILES | O=CS.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.CH2OS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1-3/h1-10H;1H,(H,2,3) |
| InChIKey | BFGAAXKWRRVBDC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;methanethioic S-acid?
The IUPAC name of 1,1'-biphenyl;methanethioic S-acid (CID 157330643) is 1,1'-biphenyl;methanethioic S-acid.
What is the SMILES notation for 1,1'-biphenyl;methanethioic S-acid?
The canonical SMILES for 1,1'-biphenyl;methanethioic S-acid is O=CS.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;methanethioic S-acid?
The InChIKey is BFGAAXKWRRVBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.CH2OS/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2-1-3/h1-10H;1H,(H,2,3).
What are the key properties of 1,1'-biphenyl;methanethioic S-acid?
1,1'-biphenyl;methanethioic S-acid has a molecular weight of 216.31 g/mol, XLogP of 3.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;methanethioic S-acid is sourced from PubChem (CID 157330643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).