About 1,1'-biphenyl;oxaldehydic acid
1,1'-biphenyl;oxaldehydic acid (PubChem CID 23024065) has the molecular formula C14H12O3
and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,1'-biphenyl;oxaldehydic acid.
Molecular Properties
| Compound Name | 1,1'-biphenyl;oxaldehydic acid |
| PubChem CID | 23024065 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 1,1'-biphenyl;oxaldehydic acid |
| SMILES | O=CC(=O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2(4)5/h1-10H;1H,(H,4,5) |
| InChIKey | VPFNVIPMUXOCRJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;oxaldehydic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;oxaldehydic acid?
The IUPAC name of 1,1'-biphenyl;oxaldehydic acid (CID 23024065) is 1,1'-biphenyl;oxaldehydic acid.
What is the SMILES notation for 1,1'-biphenyl;oxaldehydic acid?
The canonical SMILES for 1,1'-biphenyl;oxaldehydic acid is O=CC(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;oxaldehydic acid?
The InChIKey is VPFNVIPMUXOCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2(4)5/h1-10H;1H,(H,4,5).
What are the key properties of 1,1'-biphenyl;oxaldehydic acid?
1,1'-biphenyl;oxaldehydic acid has a molecular weight of 228.25 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;oxaldehydic acid is sourced from PubChem (CID 23024065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).