1,1'-biphenyl;oxaldehydic acid

C14H12O3 — CID 23024065

IUPAC1,1'-biphenyl;oxaldehydic acid
SMILESO=CC(=O)O.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.C2H2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2(4)5/h1-10H;1H,(H,4,5)
InChIKeyVPFNVIPMUXOCRJ-UHFFFAOYSA-N
MW228.25 g/mol
LogP2.62
Rot. Bonds2

About 1,1'-biphenyl;oxaldehydic acid

1,1'-biphenyl;oxaldehydic acid (PubChem CID 23024065) has the molecular formula C14H12O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 1,1'-biphenyl;oxaldehydic acid.

Molecular Properties

Compound Name1,1'-biphenyl;oxaldehydic acid
PubChem CID23024065
Molecular FormulaC14H12O3
Molecular Weight228.25 g/mol
Exact Mass228.08
IUPAC Name1,1'-biphenyl;oxaldehydic acid
SMILESO=CC(=O)O.c1ccc(-c2ccccc2)cc1
InChIInChI=1S/C12H10.C2H2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2(4)5/h1-10H;1H,(H,4,5)
InChIKeyVPFNVIPMUXOCRJ-UHFFFAOYSA-N
XLogP2.62
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.25
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1,1'-biphenyl;oxaldehydic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1'-biphenyl;oxaldehydic acid?
The IUPAC name of 1,1'-biphenyl;oxaldehydic acid (CID 23024065) is 1,1'-biphenyl;oxaldehydic acid.
What is the SMILES notation for 1,1'-biphenyl;oxaldehydic acid?
The canonical SMILES for 1,1'-biphenyl;oxaldehydic acid is O=CC(=O)O.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;oxaldehydic acid?
The InChIKey is VPFNVIPMUXOCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C2H2O3/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3-1-2(4)5/h1-10H;1H,(H,4,5).
What are the key properties of 1,1'-biphenyl;oxaldehydic acid?
1,1'-biphenyl;oxaldehydic acid has a molecular weight of 228.25 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;oxaldehydic acid is sourced from PubChem (CID 23024065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).