C14H14O2Zn — CID 70522083
acetic acid;1,1'-biphenyl;zinc (PubChem CID 70522083) has the molecular formula C14H14O2Zn and a molecular weight of 279.65 g/mol. Its IUPAC name is acetic acid;1,1'-biphenyl;zinc.
| Compound Name | acetic acid;1,1'-biphenyl;zinc |
|---|---|
| PubChem CID | 70522083 |
| Molecular Formula | C14H14O2Zn |
| Molecular Weight | 279.65 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | acetic acid;1,1'-biphenyl;zinc |
| SMILES | CC(=O)O.[Zn].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C2H4O2.Zn/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2(3)4;/h1-10H;1H3,(H,3,4); |
| InChIKey | NXOGTLRMCXDXCJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|