About acetyl chloride;4-phenylphenol
acetyl chloride;4-phenylphenol (PubChem CID 174878083) has the molecular formula C14H13ClO2
and a molecular weight of 248.71 g/mol. Its IUPAC name is acetyl chloride;4-phenylphenol.
Molecular Properties
| Compound Name | acetyl chloride;4-phenylphenol |
| PubChem CID | 174878083 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | acetyl chloride;4-phenylphenol |
| SMILES | CC(=O)Cl.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C2H3ClO/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2(3)4/h1-9,13H;1H3 |
| InChIKey | AIVGITZIEBTGBV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze acetyl chloride;4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl chloride;4-phenylphenol?
The IUPAC name of acetyl chloride;4-phenylphenol (CID 174878083) is acetyl chloride;4-phenylphenol.
What is the SMILES notation for acetyl chloride;4-phenylphenol?
The canonical SMILES for acetyl chloride;4-phenylphenol is CC(=O)Cl.Oc1ccc(-c2ccccc2)cc1.
What is the InChIKey of acetyl chloride;4-phenylphenol?
The InChIKey is AIVGITZIEBTGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C2H3ClO/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2(3)4/h1-9,13H;1H3.
What are the key properties of acetyl chloride;4-phenylphenol?
acetyl chloride;4-phenylphenol has a molecular weight of 248.71 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl chloride;4-phenylphenol is sourced from PubChem (CID 174878083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).