4-(4-hydroxyphenyl)benzoyl chloride

C13H9ClO2 — CID 87880031

IUPAC4-(4-hydroxyphenyl)benzoyl chloride
SMILESO=C(Cl)c1ccc(-c2ccc(O)cc2)cc1
InChIInChI=1S/C13H9ClO2/c14-13(16)11-3-1-9(2-4-11)10-5-7-12(15)8-6-10/h1-8,15H
InChIKeyAQYHKZNEOBDGGF-UHFFFAOYSA-N
MW232.67 g/mol
LogP3.44
Rot. Bonds2

About 4-(4-hydroxyphenyl)benzoyl chloride

4-(4-hydroxyphenyl)benzoyl chloride (PubChem CID 87880031) has the molecular formula C13H9ClO2 and a molecular weight of 232.67 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)benzoyl chloride.

Molecular Properties

Compound Name4-(4-hydroxyphenyl)benzoyl chloride
PubChem CID87880031
Molecular FormulaC13H9ClO2
Molecular Weight232.67 g/mol
Exact Mass232.03
IUPAC Name4-(4-hydroxyphenyl)benzoyl chloride
SMILESO=C(Cl)c1ccc(-c2ccc(O)cc2)cc1
InChIInChI=1S/C13H9ClO2/c14-13(16)11-3-1-9(2-4-11)10-5-7-12(15)8-6-10/h1-8,15H
InChIKeyAQYHKZNEOBDGGF-UHFFFAOYSA-N
XLogP3.44
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.67
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-(4-hydroxyphenyl)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-hydroxyphenyl)benzoyl chloride?
The IUPAC name of 4-(4-hydroxyphenyl)benzoyl chloride (CID 87880031) is 4-(4-hydroxyphenyl)benzoyl chloride.
What is the SMILES notation for 4-(4-hydroxyphenyl)benzoyl chloride?
The canonical SMILES for 4-(4-hydroxyphenyl)benzoyl chloride is O=C(Cl)c1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-(4-hydroxyphenyl)benzoyl chloride?
The InChIKey is AQYHKZNEOBDGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClO2/c14-13(16)11-3-1-9(2-4-11)10-5-7-12(15)8-6-10/h1-8,15H.
What are the key properties of 4-(4-hydroxyphenyl)benzoyl chloride?
4-(4-hydroxyphenyl)benzoyl chloride has a molecular weight of 232.67 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)benzoyl chloride is sourced from PubChem (CID 87880031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).