About benzene-1,4-diol;bis(carbonochloridic acid)
benzene-1,4-diol;bis(carbonochloridic acid) (PubChem CID 88626598) has the molecular formula C8H8Cl2O6
and a molecular weight of 271.05 g/mol. Its IUPAC name is benzene-1,4-diol;bis(carbonochloridic acid).
Molecular Properties
| Compound Name | benzene-1,4-diol;bis(carbonochloridic acid) |
| PubChem CID | 88626598 |
| Molecular Formula | C8H8Cl2O6 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | benzene-1,4-diol;bis(carbonochloridic acid) |
| SMILES | O=C(O)Cl.O=C(O)Cl.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.2CHClO2/c7-5-1-2-6(8)4-3-5;2*2-1(3)4/h1-4,7-8H;2*(H,3,4) |
| InChIKey | XYCSDJRVQIDZQO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diol;bis(carbonochloridic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diol;bis(carbonochloridic acid)?
The IUPAC name of benzene-1,4-diol;bis(carbonochloridic acid) (CID 88626598) is benzene-1,4-diol;bis(carbonochloridic acid).
What is the SMILES notation for benzene-1,4-diol;bis(carbonochloridic acid)?
The canonical SMILES for benzene-1,4-diol;bis(carbonochloridic acid) is O=C(O)Cl.O=C(O)Cl.Oc1ccc(O)cc1.
What is the InChIKey of benzene-1,4-diol;bis(carbonochloridic acid)?
The InChIKey is XYCSDJRVQIDZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.2CHClO2/c7-5-1-2-6(8)4-3-5;2*2-1(3)4/h1-4,7-8H;2*(H,3,4).
What are the key properties of benzene-1,4-diol;bis(carbonochloridic acid)?
benzene-1,4-diol;bis(carbonochloridic acid) has a molecular weight of 271.05 g/mol, XLogP of 2.90, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diol;bis(carbonochloridic acid) is sourced from PubChem (CID 88626598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).