C23H20Cl2O4 — CID 86756476
benzene-1,4-dicarbonyl chloride;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 86756476) has the molecular formula C23H20Cl2O4 and a molecular weight of 431.32 g/mol. Its IUPAC name is benzene-1,4-dicarbonyl chloride;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | benzene-1,4-dicarbonyl chloride;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 86756476 |
| Molecular Formula | C23H20Cl2O4 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | benzene-1,4-dicarbonyl chloride;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.O=C(Cl)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C15H16O2.C8H4Cl2O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;9-7(11)5-1-2-6(4-3-5)8(10)12/h3-10,16-17H,1-2H3;1-4H |
| InChIKey | FHTQJRDAJTVPAD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|