C15H16Na2O2 — CID 66941220
disodium bisphenol-A (PubChem CID 66941220) has the molecular formula C15H16Na2O2 and a molecular weight of 274.27 g/mol.
| Compound Name | disodium bisphenol-A |
|---|---|
| PubChem CID | 66941220 |
| Molecular Formula | C15H16Na2O2 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | — |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.[Na].[Na] |
| InChI | InChI=1S/C15H16O2.2Na/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;;/h3-10,16-17H,1-2H3;; |
| InChIKey | JJVKWFOGASBDAO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |