About 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane)
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) (PubChem CID 143736977) has the molecular formula C23H36O2
and a molecular weight of 344.54 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane).
Molecular Properties
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) |
| PubChem CID | 143736977 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(C)C.CC(C)C |
| InChI | InChI=1S/C15H16O2.2C4H10/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;2*1-4(2)3/h3-10,16-17H,1-2H3;2*4H,1-3H3 |
| InChIKey | JIODYNPXTWVPGC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane)?
The IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) (CID 143736977) is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane).
What is the SMILES notation for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane)?
The canonical SMILES for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) is CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.CC(C)C.CC(C)C.
What is the InChIKey of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane)?
The InChIKey is JIODYNPXTWVPGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.2C4H10/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;2*1-4(2)3/h3-10,16-17H,1-2H3;2*4H,1-3H3.
What are the key properties of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane)?
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) has a molecular weight of 344.54 g/mol, XLogP of 6.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;bis(2-methylpropane) is sourced from PubChem (CID 143736977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).