About 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver (PubChem CID 118588949) has the molecular formula C15H16AgO2
and a molecular weight of 336.16 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver.
Molecular Properties
| Compound Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver |
| PubChem CID | 118588949 |
| Molecular Formula | C15H16AgO2 |
| Molecular Weight | 336.16 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.[Ag] |
| InChI | InChI=1S/C15H16O2.Ag/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;/h3-10,16-17H,1-2H3; |
| InChIKey | DTXYBVXBBAFJCD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver?
The IUPAC name of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver (CID 118588949) is 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver.
What is the SMILES notation for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver?
The canonical SMILES for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver is CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.[Ag].
What is the InChIKey of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver?
The InChIKey is DTXYBVXBBAFJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.Ag/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;/h3-10,16-17H,1-2H3;.
What are the key properties of 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver?
4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver has a molecular weight of 336.16 g/mol, XLogP of 3.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-hydroxyphenyl)propan-2-yl]phenol;silver is sourced from PubChem (CID 118588949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).