About biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol
biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 68577534) has the molecular formula C27H24O2
and a molecular weight of 380.49 g/mol. Its IUPAC name is biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
Molecular Properties
| Compound Name | biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| PubChem CID | 68577534 |
| Molecular Formula | C27H24O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C15H16O2.C12H8/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h3-10,16-17H,1-2H3;1-8H |
| InChIKey | IGEAGCAOXBBTMC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol?
The IUPAC name of biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (CID 68577534) is biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
What is the SMILES notation for biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol?
The canonical SMILES for biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol is CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol?
The InChIKey is IGEAGCAOXBBTMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2.C12H8/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h3-10,16-17H,1-2H3;1-8H.
What are the key properties of biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol?
biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol has a molecular weight of 380.49 g/mol, XLogP of 6.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol is sourced from PubChem (CID 68577534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).