C21H22O5 — CID 159326359
benzene-1,3,5-triol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (PubChem CID 159326359) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is benzene-1,3,5-triol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol.
| Compound Name | benzene-1,3,5-triol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
|---|---|
| PubChem CID | 159326359 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | benzene-1,3,5-triol;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | CC(C)(c1ccc(O)cc1)c1ccc(O)cc1.Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H16O2.C6H6O3/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;7-4-1-5(8)3-6(9)2-4/h3-10,16-17H,1-2H3;1-3,7-9H |
| InChIKey | LEKKTWJIVRWBLB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |