C20H20Cl2O2 — CID 139675989
4-[3-(4-carbonochloridoylphenyl)-2,3-dimethylbutan-2-yl]benzoyl chloride (PubChem CID 139675989) has the molecular formula C20H20Cl2O2 and a molecular weight of 363.28 g/mol. Its IUPAC name is 4-[3-(4-carbonochloridoylphenyl)-2,3-dimethylbutan-2-yl]benzoyl chloride.
| Compound Name | 4-[3-(4-carbonochloridoylphenyl)-2,3-dimethylbutan-2-yl]benzoyl chloride |
|---|---|
| PubChem CID | 139675989 |
| Molecular Formula | C20H20Cl2O2 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 4-[3-(4-carbonochloridoylphenyl)-2,3-dimethylbutan-2-yl]benzoyl chloride |
| SMILES | CC(C)(c1ccc(C(=O)Cl)cc1)C(C)(C)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2O2/c1-19(2,15-9-5-13(6-10-15)17(21)23)20(3,4)16-11-7-14(8-12-16)18(22)24/h5-12H,1-4H3 |
| InChIKey | PQSTXBVCHSTEFJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|