About 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride
4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride (PubChem CID 161034366) has the molecular formula C18H10Cl4O5
and a molecular weight of 448.09 g/mol. Its IUPAC name is 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride.
Molecular Properties
| Compound Name | 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride |
| PubChem CID | 161034366 |
| Molecular Formula | C18H10Cl4O5 |
| Molecular Weight | 448.09 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride |
| SMILES | CC(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cc(C(=O)Cl)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C9H3Cl3O3.C9H7ClO2/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15;1-6(11)7-2-4-8(5-3-7)9(10)12/h1-3H;2-5H,1H3 |
| InChIKey | UABBOIICRKIMAQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.09 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride?
The IUPAC name of 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride (CID 161034366) is 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride.
What is the SMILES notation for 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride?
The canonical SMILES for 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride is CC(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cc(C(=O)Cl)cc(C(=O)Cl)c1.
What is the InChIKey of 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride?
The InChIKey is UABBOIICRKIMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl3O3.C9H7ClO2/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15;1-6(11)7-2-4-8(5-3-7)9(10)12/h1-3H;2-5H,1H3.
What are the key properties of 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride?
4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride has a molecular weight of 448.09 g/mol, XLogP of 5.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylbenzoyl chloride;benzene-1,3,5-tricarbonyl chloride is sourced from PubChem (CID 161034366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).