4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride

C17H11Cl3O4 — CID 160876717

IUPAC4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride
SMILESCC(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cccc(C(=O)Cl)c1
InChIInChI=1S/C9H7ClO2.C8H4Cl2O2/c1-6(11)7-2-4-8(5-3-7)9(10)12;9-7(11)5-2-1-3-6(4-5)8(10)12/h2-5H,1H3;1-4H
InChIKeySMMLAOKYKQOPMG-UHFFFAOYSA-N
MW385.63 g/mol
LogP4.71
Rot. Bonds4

About 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride

4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride (PubChem CID 160876717) has the molecular formula C17H11Cl3O4 and a molecular weight of 385.63 g/mol. Its IUPAC name is 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride.

Molecular Properties

Compound Name4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride
PubChem CID160876717
Molecular FormulaC17H11Cl3O4
Molecular Weight385.63 g/mol
Exact Mass383.97
IUPAC Name4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride
SMILESCC(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cccc(C(=O)Cl)c1
InChIInChI=1S/C9H7ClO2.C8H4Cl2O2/c1-6(11)7-2-4-8(5-3-7)9(10)12;9-7(11)5-2-1-3-6(4-5)8(10)12/h2-5H,1H3;1-4H
InChIKeySMMLAOKYKQOPMG-UHFFFAOYSA-N
XLogP4.71
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500385.63
LogP ≤ 54.71
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride?
The IUPAC name of 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride (CID 160876717) is 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride.
What is the SMILES notation for 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride?
The canonical SMILES for 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride is CC(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cccc(C(=O)Cl)c1.
What is the InChIKey of 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride?
The InChIKey is SMMLAOKYKQOPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO2.C8H4Cl2O2/c1-6(11)7-2-4-8(5-3-7)9(10)12;9-7(11)5-2-1-3-6(4-5)8(10)12/h2-5H,1H3;1-4H.
What are the key properties of 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride?
4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride has a molecular weight of 385.63 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetylbenzoyl chloride;benzene-1,3-dicarbonyl chloride is sourced from PubChem (CID 160876717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).