C9H8O2 — CID 45085895
4-acetylcyclohepta-2,4,6-trien-1-one (PubChem CID 45085895) has the molecular formula C9H8O2 and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-acetylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-acetylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 45085895 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 4-acetylcyclohepta-2,4,6-trien-1-one |
| SMILES | CC(=O)c1cccc(=O)cc1 |
| InChI | InChI=1S/C9H8O2/c1-7(10)8-3-2-4-9(11)6-5-8/h2-6H,1H3 |
| InChIKey | LJNNEYMKSLZPRH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |