C12H15ClO2 — CID 117048075
2-(4-hydroxyphenyl)-2,3-dimethylbutanoyl chloride (PubChem CID 117048075) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-2,3-dimethylbutanoyl chloride.
| Compound Name | 2-(4-hydroxyphenyl)-2,3-dimethylbutanoyl chloride |
|---|---|
| PubChem CID | 117048075 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-(4-hydroxyphenyl)-2,3-dimethylbutanoyl chloride |
| SMILES | CC(C)C(C)(C(=O)Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H15ClO2/c1-8(2)12(3,11(13)15)9-4-6-10(14)7-5-9/h4-8,14H,1-3H3 |
| InChIKey | XGPNUXNKDAOHFL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|