About 4-tert-butylphenol;nickel
4-tert-butylphenol;nickel (PubChem CID 162056786) has the molecular formula C10H14NiO
and a molecular weight of 208.91 g/mol. Its IUPAC name is 4-tert-butylphenol;nickel.
Molecular Properties
| Compound Name | 4-tert-butylphenol;nickel |
| PubChem CID | 162056786 |
| Molecular Formula | C10H14NiO |
| Molecular Weight | 208.91 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 4-tert-butylphenol;nickel |
| SMILES | CC(C)(C)c1ccc(O)cc1.[Ni] |
| InChI | InChI=1S/C10H14O.Ni/c1-10(2,3)8-4-6-9(11)7-5-8;/h4-7,11H,1-3H3; |
| InChIKey | YZHGIGHTMGYOOC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.91 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butylphenol;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylphenol;nickel?
The IUPAC name of 4-tert-butylphenol;nickel (CID 162056786) is 4-tert-butylphenol;nickel.
What is the SMILES notation for 4-tert-butylphenol;nickel?
The canonical SMILES for 4-tert-butylphenol;nickel is CC(C)(C)c1ccc(O)cc1.[Ni].
What is the InChIKey of 4-tert-butylphenol;nickel?
The InChIKey is YZHGIGHTMGYOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.Ni/c1-10(2,3)8-4-6-9(11)7-5-8;/h4-7,11H,1-3H3;.
What are the key properties of 4-tert-butylphenol;nickel?
4-tert-butylphenol;nickel has a molecular weight of 208.91 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylphenol;nickel is sourced from PubChem (CID 162056786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).