About bis(4-tert-butylphenol);zirconium
bis(4-tert-butylphenol);zirconium (PubChem CID 87864994) has the molecular formula C20H28O2Zr
and a molecular weight of 391.67 g/mol. Its IUPAC name is bis(4-tert-butylphenol);zirconium.
Molecular Properties
| Compound Name | bis(4-tert-butylphenol);zirconium |
| PubChem CID | 87864994 |
| Molecular Formula | C20H28O2Zr |
| Molecular Weight | 391.67 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | bis(4-tert-butylphenol);zirconium |
| SMILES | CC(C)(C)c1ccc(O)cc1.CC(C)(C)c1ccc(O)cc1.[Zr] |
| InChI | InChI=1S/2C10H14O.Zr/c2*1-10(2,3)8-4-6-9(11)7-5-8;/h2*4-7,11H,1-3H3; |
| InChIKey | WRBKUTMQURKKRZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(4-tert-butylphenol);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butylphenol);zirconium?
The IUPAC name of bis(4-tert-butylphenol);zirconium (CID 87864994) is bis(4-tert-butylphenol);zirconium.
What is the SMILES notation for bis(4-tert-butylphenol);zirconium?
The canonical SMILES for bis(4-tert-butylphenol);zirconium is CC(C)(C)c1ccc(O)cc1.CC(C)(C)c1ccc(O)cc1.[Zr].
What is the InChIKey of bis(4-tert-butylphenol);zirconium?
The InChIKey is WRBKUTMQURKKRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H14O.Zr/c2*1-10(2,3)8-4-6-9(11)7-5-8;/h2*4-7,11H,1-3H3;.
What are the key properties of bis(4-tert-butylphenol);zirconium?
bis(4-tert-butylphenol);zirconium has a molecular weight of 391.67 g/mol, XLogP of 5.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butylphenol);zirconium is sourced from PubChem (CID 87864994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).