C16H23ClO — CID 117048087
2-(4-tert-butylphenyl)-2,3-dimethylbutanoyl chloride (PubChem CID 117048087) has the molecular formula C16H23ClO and a molecular weight of 266.81 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2,3-dimethylbutanoyl chloride.
| Compound Name | 2-(4-tert-butylphenyl)-2,3-dimethylbutanoyl chloride |
|---|---|
| PubChem CID | 117048087 |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2,3-dimethylbutanoyl chloride |
| SMILES | CC(C)C(C)(C(=O)Cl)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23ClO/c1-11(2)16(6,14(17)18)13-9-7-12(8-10-13)15(3,4)5/h7-11H,1-6H3 |
| InChIKey | PGQPGEGARKKVEJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|